|
CAS#: 29548-13-8 Product: 2-(4-Methylidenecyclohexyl)Prop-2-En-1-Ol No suppilers available for the product. |
| Name | 2-(4-Methylidenecyclohexyl)Prop-2-En-1-Ol |
|---|---|
| Synonyms | 2-(4-Methylenecyclohexyl)Prop-2-En-1-Ol; 2-(4-Methylenecyclohexyl)-2-Propen-1-Ol; P-Mentha-1(7),8(10)-Dien-9-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 |
| CAS Registry Number | 29548-13-8 |
| SMILES | C(C(=C)[CH]1CC[C](CC1)=[CH2])O |
| InChI | 1S/C10H16O/c1-8-3-5-10(6-4-8)9(2)7-11/h10-11H,1-7H2 |
| InChIKey | SDDQNZKSVASSFO-UHFFFAOYSA-N |
| Density | 0.93g/cm3 (Cal.) |
|---|---|
| Boiling point | 235.345°C at 760 mmHg (Cal.) |
| Flash point | 95.989°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylidenecyclohexyl)Prop-2-En-1-Ol |