Online Database of Chemicals from Around the World
|
CAS#: 29549-18-6 Product: 1-[2,6-Dimethyl-4-(2-Methyl-2-Propanyl)Phenyl]-3-Phenyl-2-Butanone No suppilers available for the product. |
| Name | 1-[2,6-Dimethyl-4-(2-Methyl-2-Propanyl)Phenyl]-3-Phenyl-2-Butanone |
|---|---|
| Synonyms | 1-(4-tert-Butyl-2,6-dimethylphenyl)-3-phenyl-2-butanone # |
| Molecular Structure | ![CAS#: 29549-18-6, 1-[2,6-Dimethyl-4-(2-Methyl-2-Propanyl)Phenyl]-3-Phenyl-2-Butanone](/moreStructures/29549-18-6.gif) |
| Molecular Formula | C22H28O |
| Molecular Weight | 308.46 |
| CAS Registry Number | 29549-18-6 |
| SMILES | O=C(Cc1c(cc(cc1C)C(C)(C)C)C)C(c2ccccc2)C |
| InChI | 1S/C22H28O/c1-15-12-19(22(4,5)6)13-16(2)20(15)14-21(23)17(3)18-10-8-7-9-11-18/h7-13,17H,14H2,1-6H3 |
| InChIKey | OOVFRWWFJOSTLC-UHFFFAOYSA-N |
| Density | 0.985g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.454°C at 760 mmHg (Cal.) |
| Flash point | 123.785°C (Cal.) |
| Refractive index | 1.536 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[2,6-Dimethyl-4-(2-Methyl-2-Propanyl)Phenyl]-3-Phenyl-2-Butanone |