|
CAS#: 29605-46-7 Product: Spermine hydrochloride No suppilers available for the product. |
| Name | Spermine hydrochloride |
|---|---|
| Synonyms | 3-[4-(3-Aminopropylamino)Butylamino]Propylammonium Chloride; 1,4-Butanediamine, N,N'-Bis(3-Aminopropyl)-, Hydrochloride; 4,9-Diaza-1,12-Dodecanediamine Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C10H27ClN4 |
| Molecular Weight | 238.80 |
| CAS Registry Number | 29605-46-7 |
| SMILES | C(CCNCCC[NH3+])CNCCCN.[Cl-] |
| InChI | 1S/C10H26N4.ClH/c11-5-3-9-13-7-1-2-8-14-10-4-6-12;/h13-14H,1-12H2;1H |
| InChIKey | KBDDIZRDKLGWGW-UHFFFAOYSA-N |
| Boiling point | 308.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 175.6°C (Cal.) |
| (1) | Jennifer A. Dougan, Douglas MacRae, Duncan Graham and Karen Faulds. DNA detection using enzymatic signal production and SERS, Chem. Commun., 2011, 47, 4649. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Spermine hydrochloride |