|
CAS#: 29625-75-0 Product: 2-Deoxy-D-Erythro-Pentonic Acid No suppilers available for the product. |
| Name | 2-Deoxy-D-Erythro-Pentonic Acid |
|---|---|
| Synonyms | 2-Deoxyribonic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C5H10O5 |
| Molecular Weight | 150.13 |
| CAS Registry Number | 29625-75-0 |
| SMILES | O=C(O)C[C@H](O)[C@H](O)CO |
| InChI | 1S/C5H10O5/c6-2-4(8)3(7)1-5(9)10/h3-4,6-8H,1-2H2,(H,9,10)/t3-,4+/m0/s1 |
| InChIKey | VBUWJOHKCBQXNU-IUYQGCFVSA-N |
| Density | 1.516g/cm3 (Cal.) |
|---|---|
| Boiling point | 488.1°C at 760 mmHg (Cal.) |
| Flash point | 263.1°C (Cal.) |
| Refractive index | 1.545 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Deoxy-D-Erythro-Pentonic Acid |