|
CAS#: 2964-23-0 Product: Phenatine No suppilers available for the product. |
| Name | Phenatine |
|---|---|
| Synonyms | N-(1-Methyl-2-Phenyl-Ethyl)Pyridine-3-Carboxamide; Phosphoric Acid; N-(1-Methyl-2-Phenylethyl)-3-Pyridinecarboxamide; Phosphoric Acid; N-(1-Methyl-2-Phenyl-Ethyl)Nicotinamide; Phosphoric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22N2O9P2 |
| Molecular Weight | 436.29 |
| CAS Registry Number | 2964-23-0 |
| SMILES | O=[P](O)(O)O.O=[P](O)(O)O.C(C(NC(=O)C1=CC=CN=C1)C)C2=CC=CC=C2 |
| InChI | 1S/C15H16N2O.2H3O4P/c1-12(10-13-6-3-2-4-7-13)17-15(18)14-8-5-9-16-11-14;2*1-5(2,3)4/h2-9,11-12H,10H2,1H3,(H,17,18);2*(H3,1,2,3,4) |
| InChIKey | ZDZWSXDFNBHJFZ-UHFFFAOYSA-N |
| Boiling point | 465.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 235.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenatine |