|
CAS#: 296778-53-5 Product: 2-Methyl-2-Propanyl [(1R,2S)-2-Hydroxycyclohexyl]Carbamate No suppilers available for the product. |
| Name | 2-Methyl-2-Propanyl [(1R,2S)-2-Hydroxycyclohexyl]Carbamate |
|---|---|
| Synonyms | tert-butyl ((1R,2S)-2-hydroxycyclohexyl)carbamate |
| Molecular Structure | ![]() |
| Molecular Formula | C11H21NO3 |
| Molecular Weight | 215.29 |
| CAS Registry Number | 296778-53-5 |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCCC[C@@H]1O |
| InChI | 1S/C11H21NO3/c1-11(2,3)15-10(14)12-8-6-4-5-7-9(8)13/h8-9,13H,4-7H2,1-3H3,(H,12,14)/t8-,9+/m1/s1 |
| InChIKey | XVROWZPERFUOCE-BDAKNGLRSA-N |
| Density | 1.066g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.714°C at 760 mmHg (Cal.) |
| Flash point | 158.044°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propanyl [(1R,2S)-2-Hydroxycyclohexyl]Carbamate |