Online Database of Chemicals from Around the World
|
CAS#: 29706-46-5 Product: 2,5-Diamino-1,8-Dihydroxyanthraquinone No suppilers available for the product. |
| Name | 2,5-Diamino-1,8-Dihydroxyanthraquinone |
|---|---|
| Synonyms | 2,5-Diamino-1,8-Dihydroxy-Anthracene-9,10-Dione; 2,5-Diamino-1,8-Dihydroxy-9,10-Anthraquinone; 2,5-Diamino-1,8-Dihydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H10N2O4 |
| Molecular Weight | 270.24 |
| CAS Registry Number | 29706-46-5 |
| EINECS | 249-789-5 |
| SMILES | C1=C2C(=C(O)C(=C1)N)C(=O)C3=C(C2=O)C(=CC=C3O)N |
| InChI | 1S/C14H10N2O4/c15-6-3-4-8(17)11-10(6)12(18)5-1-2-7(16)13(19)9(5)14(11)20/h1-4,17,19H,15-16H2 |
| InChIKey | KKIZIJGDUTUFQL-UHFFFAOYSA-N |
| Density | 1.684g/cm3 (Cal.) |
|---|---|
| Boiling point | 617.206°C at 760 mmHg (Cal.) |
| Flash point | 327.075°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diamino-1,8-Dihydroxyanthraquinone |