| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
![]() |
+86 13417589054//+86 13424336463 | |||
![]() |
info@atomaxchem.com,atomax.chemicals@gmail.com, | |||
![]() |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Methyl (1S,3R,4R)-2-Azabicyclo[2.2.1]Heptane-3-Carboxylate |
|---|---|
| Synonyms | (1S,3R,4R |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.19 |
| CAS Registry Number | 297143-31-8 |
| SMILES | COC(=O)[C@H]1[C@@H]2CC[C@@H](C2)N1 |
| InChI | 1S/C8H13NO2/c1-11-8(10)7-5-2-3-6(4-5)9-7/h5-7,9H,2-4H2,1H3/t5-,6+,7-/m1/s1 |
| InChIKey | HPVCCAYXVXMOOP-DSYKOEDSSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 215.1±23.0°C at 760 mmHg (Cal.) |
| Flash point | 83.9±22.6°C (Cal.) |
| Refractive index | 1.488 (Cal.) |
| (1) | Jenny K. Ekegren, Peter Roth, Klas Källström, Tibor Tarnai and Pher G. Andersson. Synthesis and evaluation of N,S-compounds as chiral ligands for transfer hydrogenation of acetophenone, Org. Biomol. Chem., 2003, 1, 358. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Methyl (1S,3R,4R)-2-Azabicyclo[2.2.1]Heptane-3-Carboxylate |