|
CAS#: 2973-21-9 Product: N-Methyl-2-Nitrobenzene-1,4-Diamine No suppilers available for the product. |
| Name | N-Methyl-2-Nitrobenzene-1,4-Diamine |
|---|---|
| Synonyms | N'-Methyl-2-Nitro-Benzene-1,4-Diamine; (4-Amino-3-Nitro-Phenyl)-Methyl-Amine; N-Methyl-3-Nitro-P-Phenylenediamine |
| Molecular Structure | ![]() |
| Molecular Formula | C7H9N3O2 |
| Molecular Weight | 167.17 |
| CAS Registry Number | 2973-21-9 |
| EINECS | 221-014-5 |
| SMILES | C1=C(NC)C=CC(=C1[N+]([O-])=O)N |
| InChI | 1S/C7H9N3O2/c1-9-5-2-3-6(8)7(4-5)10(11)12/h2-4,9H,8H2,1H3 |
| InChIKey | XSHZMHVULBOPDY-UHFFFAOYSA-N |
| Density | 1.359g/cm3 (Cal.) |
|---|---|
| Boiling point | 341.227°C at 760 mmHg (Cal.) |
| Flash point | 160.169°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Methyl-2-Nitrobenzene-1,4-Diamine |