|
CAS#: 29764-66-7 Product: 2-(Isopropylamino)-1-[3-Methyl-4-(Methylsulfanyl)Phenyl]Ethanol No suppilers available for the product. |
| Name | 2-(Isopropylamino)-1-[3-Methyl-4-(Methylsulfanyl)Phenyl]Ethanol |
|---|---|
| Synonyms | NSC288406 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H21NOS |
| Molecular Weight | 239.38 |
| CAS Registry Number | 29764-66-7 |
| SMILES | S(c1ccc(cc1C)C(O)CNC(C)C)C |
| InChI | 1S/C13H21NOS/c1-9(2)14-8-12(15)11-5-6-13(16-4)10(3)7-11/h5-7,9,12,14-15H,8H2,1-4H3 |
| InChIKey | RACXDCLXISSWSX-UHFFFAOYSA-N |
| Density | 1.065g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.481°C at 760 mmHg (Cal.) |
| Flash point | 184.513°C (Cal.) |
| Refractive index | 1.557 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Isopropylamino)-1-[3-Methyl-4-(Methylsulfanyl)Phenyl]Ethanol |