|
CAS#: 2977-19-7 Product: 2-[2-(Dimethylamino)Ethyl]-3-Methyl-2-Phenylvaleramide No suppilers available for the product. |
| Name | 2-[2-(Dimethylamino)Ethyl]-3-Methyl-2-Phenylvaleramide |
|---|---|
| Synonyms | 2-(2-Dimethylaminoethyl)-3-Methyl-2-Phenyl-Pentanamide; 2-(2-Dimethylaminoethyl)-3-Methyl-2-Phenyl-Valeramide; Brn 2813331 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26N2O |
| Molecular Weight | 262.39 |
| CAS Registry Number | 2977-19-7 |
| SMILES | C1=C(C(C(CC)C)(C(=O)N)CCN(C)C)C=CC=C1 |
| InChI | 1S/C16H26N2O/c1-5-13(2)16(15(17)19,11-12-18(3)4)14-9-7-6-8-10-14/h6-10,13H,5,11-12H2,1-4H3,(H2,17,19) |
| InChIKey | BROSADJFIKBHRF-UHFFFAOYSA-N |
| Density | 0.995g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.901°C at 760 mmHg (Cal.) |
| Flash point | 202.306°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(Dimethylamino)Ethyl]-3-Methyl-2-Phenylvaleramide |