|
CAS#: 2979-56-8 Product: Thiohippuric acid O-methyl ester No suppilers available for the product. |
| Name | Thiohippuric acid O-methyl ester |
|---|---|
| Synonyms | 2-[[(2-Methylphenyl)-Oxomethyl]Amino]Ethanethioic S-Acid; 2-[(2-Methylbenzoyl)Amino]Thioacetic Acid; 2-[(2-Methylphenyl)Carbonylamino]Ethanethioic S-Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.26 |
| CAS Registry Number | 2979-56-8 |
| SMILES | C1=C(C(=CC=C1)C(NCC(=O)S)=O)C |
| InChI | 1S/C10H11NO2S/c1-7-4-2-3-5-8(7)10(13)11-6-9(12)14/h2-5H,6H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | JZMBKLDMLQKQMZ-UHFFFAOYSA-N |
| Density | 1.205g/cm3 (Cal.) |
|---|---|
| Boiling point | 390.103°C at 760 mmHg (Cal.) |
| Flash point | 189.728°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Thiohippuric acid O-methyl ester |