|
CAS#: 29837-12-5 Product: (1S,4S,4aR)-4-Isopropyl-1,6-Dimethyl-1,2,3,4,4A,7-Hexahydronaphthalene No suppilers available for the product. |
| Name | (1S,4S,4aR)-4-Isopropyl-1,6-Dimethyl-1,2,3,4,4A,7-Hexahydronaphthalene |
|---|---|
| Synonyms | cubenene; trans-cadina-1,4-diene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 29837-12-5 |
| SMILES | CC(C)[C@@H]2CC[C@H](C)\C1=C\CC(\C)=C/[C@H]12 |
| InChI | 1S/C15H24/c1-10(2)13-8-6-12(4)14-7-5-11(3)9-15(13)14/h7,9-10,12-13,15H,5-6,8H2,1-4H3/t12-,13-,15-/m0/s1 |
| InChIKey | JUQGWBAOQUBVFP-YDHLFZDLSA-N |
| Density | 0.899g/cm3 (Cal.) |
|---|---|
| Boiling point | 279.203°C at 760 mmHg (Cal.) |
| Flash point | 110.246°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,4S,4aR)-4-Isopropyl-1,6-Dimethyl-1,2,3,4,4A,7-Hexahydronaphthalene |