|
CAS#: 2984-59-0 Product: (4-Methyl-1,3-dithiolan-2-ylidene)-Phosphoramidic acid dimethyl ester No suppilers available for the product. |
| Name | (4-Methyl-1,3-dithiolan-2-ylidene)-Phosphoramidic acid dimethyl ester |
|---|---|
| Synonyms | (Z)-Dimethoxyphosphoryl-(4-Methyl-1,3-Dithiolan-2-Ylidene)Amine; (E)-Dimethoxyphosphoryl-(4-Methyl-1,3-Dithiolan-2-Ylidene)Amine; Ac 47772 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12NO3PS2 |
| Molecular Weight | 241.26 |
| CAS Registry Number | 2984-59-0 |
| SMILES | CC1SC(SC1)=N[P](OC)(OC)=O |
| InChI | 1S/C6H12NO3PS2/c1-5-4-12-6(13-5)7-11(8,9-2)10-3/h5H,4H2,1-3H3 |
| InChIKey | GHPRZTDZWGKPQX-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.445°C at 760 mmHg (Cal.) |
| Flash point | 144.576°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Methyl-1,3-dithiolan-2-ylidene)-Phosphoramidic acid dimethyl ester |