|
CAS#: 29886-98-4 Product: N-Cyclohexyl-N'-[2-(2-Methyl-4-Morpholinyl)Ethyl]Carbodiimide 4-Methylbenzenesulfonate (1:1) No suppilers available for the product. |
| Name | N-Cyclohexyl-N'-[2-(2-Methyl-4-Morpholinyl)Ethyl]Carbodiimide 4-Methylbenzenesulfonate (1:1) |
|---|---|
| Synonyms | cyclohexy |
| Molecular Structure | ![]() |
| Molecular Formula | C21H33N3O4S |
| Molecular Weight | 423.57 |
| CAS Registry Number | 29886-98-4 |
| EINECS | 249-930-0 |
| SMILES | OS(=O)(=O)c1ccc(C)cc1.CC2CN(CC\N=C=N/C1CCCCC1)CCO2 |
| InChI | 1S/C14H25N3O.C7H8O3S/c1-13-11-17(9-10-18-13)8-7-15-12-16-14-5-3-2-4-6-14;1-6-2-4-7(5-3-6)11(8,9)10/h13-14H,2-11H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AVFDIFVXGWEJME-UHFFFAOYSA-N |
| Boiling point | 560.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 292.8°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Cyclohexyl-N'-[2-(2-Methyl-4-Morpholinyl)Ethyl]Carbodiimide 4-Methylbenzenesulfonate (1:1) |