Online Database of Chemicals from Around the World
|
CAS#: 30011-11-1 Product: 2,3-Bis(4-Methoxyphenyl)-5-Methyl-1H-Pyrrole No suppilers available for the product. |
| Name | 2,3-Bis(4-Methoxyphenyl)-5-Methyl-1H-Pyrrole |
|---|---|
| Synonyms | 2-Methyl-4,5-Bis(P-Methoxyphenyl)Pyrrole; 5-21-05-00384 (Beilstein Handbook Reference); Brn 1540015 |
| Molecular Structure |  |
| Molecular Formula | C19H19NO2 |
| Molecular Weight | 293.36 |
| CAS Registry Number | 30011-11-1 |
| SMILES | C1=C(C)[NH]C(=C1C2=CC=C(C=C2)OC)C3=CC=C(OC)C=C3 |
| InChI | 1S/C19H19NO2/c1-13-12-18(14-4-8-16(21-2)9-5-14)19(20-13)15-6-10-17(22-3)11-7-15/h4-12,20H,1-3H3 |
| InChIKey | WABWKXZHYGHSCI-UHFFFAOYSA-N |
| Density | 1.117g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.157°C at 760 mmHg (Cal.) |
| Flash point | 155.708°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,3-Bis(4-Methoxyphenyl)-5-Methyl-1H-Pyrrole |