|
CAS#: 30067-00-6 Product: Methyl 2-Hydroxy-3-(4-Methoxyphenyl)-3-[(2-Nitrophenyl)Sulfanyl]Propanoate No suppilers available for the product. |
| Name | Methyl 2-Hydroxy-3-(4-Methoxyphenyl)-3-[(2-Nitrophenyl)Sulfanyl]Propanoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H17NO6S |
| Molecular Weight | 363.39 |
| CAS Registry Number | 30067-00-6 |
| SMILES | [O-][N+](=O)c2ccccc2SC(c1ccc(OC)cc1)C(O)C(=O)OC |
| InChI | 1S/C17H17NO6S/c1-23-12-9-7-11(8-10-12)16(15(19)17(20)24-2)25-14-6-4-3-5-13(14)18(21)22/h3-10,15-16,19H,1-2H3 |
| InChIKey | FULUJKXDCQTJJV-UHFFFAOYSA-N |
| Density | 1.372g/cm3 (Cal.) |
|---|---|
| Boiling point | 534.581°C at 760 mmHg (Cal.) |
| Flash point | 277.105°C (Cal.) |
| Refractive index | 1.626 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2-Hydroxy-3-(4-Methoxyphenyl)-3-[(2-Nitrophenyl)Sulfanyl]Propanoate |