|
CAS#: 301134-94-1 Product: 2-[4-(2-Methoxyphenyl)-1-Piperidinyl]-5-Nitrobenzaldehyde No suppilers available for the product. |
| Name | 2-[4-(2-Methoxyphenyl)-1-Piperidinyl]-5-Nitrobenzaldehyde |
|---|---|
| Synonyms | 2-[4-(2-methoxyphenyl)piperidino]-5-nitrobenzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.37 |
| CAS Registry Number | 301134-94-1 |
| SMILES | [O-][N+](=O)c1cc(c(cc1)N3CCC(c2ccccc2OC)CC3)C=O |
| InChI | 1S/C19H20N2O4/c1-25-19-5-3-2-4-17(19)14-8-10-20(11-9-14)18-7-6-16(21(23)24)12-15(18)13-22/h2-7,12-14H,8-11H2,1H3 |
| InChIKey | TXTKGNOXCFAQCD-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 524.834°C at 760 mmHg (Cal.) |
| Flash point | 271.21°C (Cal.) |
| Refractive index | 1.616 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(2-Methoxyphenyl)-1-Piperidinyl]-5-Nitrobenzaldehyde |