Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | Dibutyl 3,4,5,6-Tetrachlorobenzene-1,2-Dicarboxylate |
|---|---|
| Synonyms | 3,4,5,6-Tetrachlorobenzene-1,2-Dicarboxylic Acid Dibutyl Ester; 1,2-Benzenedicarboxylic Acid, 3,4,5,6-Tetrachloro-, Dibutyl Ester; 3,4,5,6-Tetrachloro-1,2-Benzenedicarboxylic Acid, Dibutyl Ester |
| Molecular Structure |  |
| Molecular Formula | C16H18Cl4O4 |
| Molecular Weight | 416.13 |
| CAS Registry Number | 3015-66-5 |
| EINECS | 221-152-6 |
| SMILES | C(OC(C1=C(C(=C(C(=C1C(OCCCC)=O)Cl)Cl)Cl)Cl)=O)CCC |
| InChI | 1S/C16H18Cl4O4/c1-3-5-7-23-15(21)9-10(16(22)24-8-6-4-2)12(18)14(20)13(19)11(9)17/h3-8H2,1-2H3 |
| InChIKey | CZYWSKLOYGOGRT-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.559°C at 760 mmHg (Cal.) |
| Flash point | 156.964°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutyl 3,4,5,6-Tetrachlorobenzene-1,2-Dicarboxylate |