|
CAS#: 301823-87-0 Product: 4-Phenyl-3,5-Cyclohexadiene-1,1,2,2,3,6-Hexol No suppilers available for the product. |
| Name | 4-Phenyl-3,5-Cyclohexadiene-1,1,2,2,3,6-Hexol |
|---|---|
| Synonyms | [1,1-Biphenyl]-2,3,3,4,4,5-hexol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12O6 |
| Molecular Weight | 252.22 |
| CAS Registry Number | 301823-87-0 |
| SMILES | c1ccc(cc1)C2=C(C(C(C(=C2)O)(O)O)(O)O)O |
| InChI | 1S/C12H12O6/c13-9-6-8(7-4-2-1-3-5-7)10(14)12(17,18)11(9,15)16/h1-6,13-18H |
| InChIKey | NCZXZGKEGGTDSR-UHFFFAOYSA-N |
| Density | 1.94g/cm3 (Cal.) |
|---|---|
| Boiling point | 474.663°C at 760 mmHg (Cal.) |
| Flash point | 236.66°C (Cal.) |
| Refractive index | 1.904 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Phenyl-3,5-Cyclohexadiene-1,1,2,2,3,6-Hexol |