|
CAS#: 3024-71-3 Product: (3-Benzyl-2-Methyldecan-2-Yl)Azanium Chloride No suppilers available for the product. |
| Name | (3-Benzyl-2-Methyldecan-2-Yl)Azanium Chloride |
|---|---|
| Synonyms | (2-Benzyl-1,1-Dimethyl-Nonyl)Ammonium Chloride; (2-Benzyl-1,1-Dimethylnonyl)Ammonium Chloride; [2-Methyl-3-(Phenylmethyl)Decan-2-Yl]Azanium Chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C18H32ClN |
| Molecular Weight | 297.91 |
| CAS Registry Number | 3024-71-3 |
| EINECS | 221-176-7 |
| SMILES | C1=CC=CC=C1CC(C([NH3+])(C)C)CCCCCCC.[Cl-] |
| InChI | 1S/C18H31N.ClH/c1-4-5-6-7-11-14-17(18(2,3)19)15-16-12-9-8-10-13-16;/h8-10,12-13,17H,4-7,11,14-15,19H2,1-3H3;1H |
| InChIKey | QOEBKZPUTLKJHK-UHFFFAOYSA-N |
| Boiling point | 357.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 147.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3-Benzyl-2-Methyldecan-2-Yl)Azanium Chloride |