|
CAS#: 30257-03-5 Product: Pimarane No suppilers available for the product. |
| Name | Pimarane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H36 |
| Molecular Weight | 276.50 |
| CAS Registry Number | 30257-03-5 |
| SMILES | C1C[C@@](C[C@H]2[C@H]1[C@@]3([C@@H](CC2)C(C)(C)CCC3)C)(C)CC |
| InChI | 1S/C20H36/c1-6-19(4)13-10-16-15(14-19)8-9-17-18(2,3)11-7-12-20(16,17)5/h15-17H,6-14H2,1-5H3/t15-,16-,17-,19+,20+/m0/s1 |
| InChIKey | GZHFBZCDMVGRTI-HROONELDSA-N |
| Density | 0.865g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.69°C at 760 mmHg (Cal.) |
| Flash point | 149.457°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pimarane |