|
CAS#: 30316-20-2 Product: Methyl 4-(2,5-Dimethylphenyl)-3-Methylbutanoate No suppilers available for the product. |
| Name | Methyl 4-(2,5-Dimethylphenyl)-3-Methylbutanoate |
|---|---|
| Synonyms | Methyl 4-(2,5-dimethylphenyl)-3-methylbutanoate # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 30316-20-2 |
| SMILES | O=C(OC)CC(C)Cc1cc(ccc1C)C |
| InChI | 1S/C14H20O2/c1-10-5-6-12(3)13(7-10)8-11(2)9-14(15)16-4/h5-7,11H,8-9H2,1-4H3 |
| InChIKey | JZXYPBKEOMQQKA-UHFFFAOYSA-N |
| Density | 0.981g/cm3 (Cal.) |
|---|---|
| Boiling point | 309.292°C at 760 mmHg (Cal.) |
| Flash point | 116.303°C (Cal.) |
| Refractive index | 1.497 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 4-(2,5-Dimethylphenyl)-3-Methylbutanoate |