|
CAS#: 30316-23-5 Product: 2,5,8-Trimethyl-1,2-Dihydronaphthalene No suppilers available for the product. |
| Name | 2,5,8-Trimethyl-1,2-Dihydronaphthalene |
|---|---|
| Synonyms | 1,2-Dihydro-2,5,8-Trimethylnaphthalene; Naphthalene, 1,2-Dihydro-2,5,8-Trimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16 |
| Molecular Weight | 172.27 |
| CAS Registry Number | 30316-23-5 |
| SMILES | C1=CC(=C2C(=C1C)CC(C=C2)C)C |
| InChI | 1S/C13H16/c1-9-4-7-12-10(2)5-6-11(3)13(12)8-9/h4-7,9H,8H2,1-3H3 |
| InChIKey | IQEGNNWKVCUHQL-UHFFFAOYSA-N |
| Density | 0.946g/cm3 (Cal.) |
|---|---|
| Boiling point | 254.88°C at 760 mmHg (Cal.) |
| Flash point | 103.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5,8-Trimethyl-1,2-Dihydronaphthalene |