|
CAS#: 30369-88-1 Product: 4,6-Dichloro-N-Naphthalen-1-Yl-1,3,5-Triazin-2-Amine No suppilers available for the product. |
| Name | 4,6-Dichloro-N-Naphthalen-1-Yl-1,3,5-Triazin-2-Amine |
|---|---|
| Synonyms | 4,6-Dichloro-N-(1-Naphthyl)-1,3,5-Triazin-2-Amine; (4,6-Dichloro-S-Triazin-2-Yl)-(1-Naphthyl)Amine; Aids-143225 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H8Cl2N4 |
| Molecular Weight | 291.14 |
| CAS Registry Number | 30369-88-1 |
| SMILES | C1=CC=C3C(=C1NC2=NC(=NC(=N2)Cl)Cl)C=CC=C3 |
| InChI | 1S/C13H8Cl2N4/c14-11-17-12(15)19-13(18-11)16-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H,(H,16,17,18,19) |
| InChIKey | DDGDKGONLRLJDM-UHFFFAOYSA-N |
| Density | 1.507g/cm3 (Cal.) |
|---|---|
| Boiling point | 532.866°C at 760 mmHg (Cal.) |
| Flash point | 276.068°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,6-Dichloro-N-Naphthalen-1-Yl-1,3,5-Triazin-2-Amine |