|
CAS#: 30382-71-9 Product: 2-[2-(Triethoxysilyl)Ethyl]Pyridine No suppilers available for the product. |
| Name | 2-[2-(Triethoxysilyl)Ethyl]Pyridine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C13H23NO3Si |
| Molecular Weight | 269.41 |
| CAS Registry Number | 30382-71-9 |
| SMILES | CCO[Si](CCc1ccccn1)(OCC)OCC |
| InChI | 1S/C13H23NO3Si/c1-4-15-18(16-5-2,17-6-3)12-10-13-9-7-8-11-14-13/h7-9,11H,4-6,10,12H2,1-3H3 |
| InChIKey | KMLVDTJUQJXRRH-UHFFFAOYSA-N |
| Density | 1g/cm3 (Cal.) |
|---|---|
| Boiling point | 299.578°C at 760 mmHg (Cal.) |
| Flash point | 134.98°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[2-(Triethoxysilyl)Ethyl]Pyridine |