|
CAS#: 30394-86-6 Product: 2-Methyl-2-Propenoic acid methyl ester, polymer with ethyl 2-propenoate and 2-methyl-2-propenamide No suppilers available for the product. |
| Name | 2-Methyl-2-Propenoic acid methyl ester, polymer with ethyl 2-propenoate and 2-methyl-2-propenamide |
|---|---|
| Synonyms | 2-Methylprop-2-Enamide; 2-Methylprop-2-Enoic Acid Methyl Ester; Prop-2-Enoic Acid Ethyl Ester; Acrylic Acid Ethyl Ester; Methacrylamide; 2-Methylacrylic Acid Methyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 |
| CAS Registry Number | 30394-86-6 |
| SMILES | CC(C(OC)=O)=C.C(OC(=O)C=C)C.CC(C(=O)N)=C |
| InChI | 1S/2C5H8O2.C4H7NO/c1-4(2)5(6)7-3;1-3-5(6)7-4-2;1-3(2)4(5)6/h1H2,2-3H3;3H,1,4H2,2H3;1H2,2H3,(H2,5,6) |
| InChIKey | WNHTUTLKXSFQBE-UHFFFAOYSA-N |
| Boiling point | 99.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 15.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-2-Propenoic acid methyl ester, polymer with ethyl 2-propenoate and 2-methyl-2-propenamide |