|
CAS#: 30451-33-3 Product: 4,7-Dihydro-2-(P-Tolyl)-4,7-Methanoisoindole No suppilers available for the product. |
| Name | 4,7-Dihydro-2-(P-Tolyl)-4,7-Methanoisoindole |
|---|---|
| Synonyms | 4,7-Methanoisoindole, 4,7-Dihydro-2-(P-Tolyl)-; Brn 1249163 |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 |
| CAS Registry Number | 30451-33-3 |
| SMILES | C1=C3C(=C[N]1C2=CC=C(C=C2)C)C4C=CC3C4 |
| InChI | 1S/C16H15N/c1-11-2-6-14(7-3-11)17-9-15-12-4-5-13(8-12)16(15)10-17/h2-7,9-10,12-13H,8H2,1H3 |
| InChIKey | AUYIENLMFAWSLX-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.875°C at 760 mmHg (Cal.) |
| Flash point | 166.608°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dihydro-2-(P-Tolyl)-4,7-Methanoisoindole |