|
CAS#: 30517-65-8 Product: 6-Deoxyversicolorin A No suppilers available for the product. |
| Name | 6-Deoxyversicolorin A |
|---|---|
| Synonyms | Anthra(2,3-B)Furo(3,2-D)Furan-5,10-Dione, 3A,12A-Dihydro-4,6-Dihydroxy-; Brn 1403071 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H10O6 |
| Molecular Weight | 322.27 |
| CAS Registry Number | 30517-65-8 |
| SMILES | C1=C5C(=C(C2=C1C(=O)C3=C(C2=O)C(=CC=C3)O)O)C4C(OC=C4)O5 |
| InChI | 1S/C18H10O6/c19-10-3-1-2-7-12(10)16(21)14-9(15(7)20)6-11-13(17(14)22)8-4-5-23-18(8)24-11/h1-6,8,18-19,22H |
| InChIKey | QLPXJOSOFOPAMO-UHFFFAOYSA-N |
| Density | 1.656g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.148°C at 760 mmHg (Cal.) |
| Flash point | 199.32°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Deoxyversicolorin A |