|
CAS#: 30546-08-8 Product: 2-Amino-9-Butyl-3H-Purine-6-Thione No suppilers available for the product. |
| Name | 2-Amino-9-Butyl-3H-Purine-6-Thione |
|---|---|
| Synonyms | 6H-Purine-6-Thione, 2-Amino-9-Butyl-1,9-Dihydro-; 9-Btg; 9-Butyl-6-Thioguanine |
| Molecular Structure | ![]() |
| Molecular Formula | C9H13N5S |
| Molecular Weight | 223.30 |
| CAS Registry Number | 30546-08-8 |
| SMILES | C2=NC1=C(NC(=NC1=S)N)[N]2CCCC |
| InChI | 1S/C9H13N5S/c1-2-3-4-14-5-11-6-7(14)12-9(10)13-8(6)15/h5H,2-4H2,1H3,(H3,10,12,13,15) |
| InChIKey | RNDPRLLVMLFXLY-UHFFFAOYSA-N |
| Density | 1.489g/cm3 (Cal.) |
|---|---|
| Boiling point | 476.274°C at 760 mmHg (Cal.) |
| Flash point | 241.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Amino-9-Butyl-3H-Purine-6-Thione |