Online Database of Chemicals from Around the World
| Name | 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,8,8,8a-Heptadecafluoro-7-(Trifluoromethyl)Naphthalene |
|---|---|
| Synonyms | 1,1,2,2,3,3,4,4,4A,5,5,6,6,7,8,8,8A-Heptadecafluoro-7-(Trifluoromethyl)Decalin; 1,1,2,2,3,3,4,4,4A,5,5,6,6,7,8,8,8A-Heptadecafluorodecahydro-7-(Trifluoromethyl)Naphthalene |
| Molecular Structure |  |
| Molecular Formula | C11F20 |
| Molecular Weight | 512.09 |
| CAS Registry Number | 306-95-6 |
| EINECS | 206-194-5 |
| SMILES | FC12C(F)(C(F)(F)C(F)(F)C(F)(C1(F)F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)C2(F)F |
| InChI | 1S/C11F20/c12-1-2(13,7(21,22)10(27,28)9(25,26)6(1,19)20)5(17,18)8(23,24)3(14,4(1,15)16)11(29,30)31 |
| InChIKey | DVPQLHWKBCBNDB-UHFFFAOYSA-N |
| Density | 1.841g/cm3 (Cal.) |
|---|---|
| Boiling point | 146.622°C at 760 mmHg (Cal.) |
| Flash point | 51.159°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,2,2,3,3,4,4,4a,5,5,6,6,7,8,8,8a-Heptadecafluoro-7-(Trifluoromethyl)Naphthalene |
