|
CAS#: 30625-58-2 Product: 4-(4-Dimethylaminophenyl)But-3-En-2-One No suppilers available for the product. |
| Name | 4-(4-Dimethylaminophenyl)But-3-En-2-One |
|---|---|
| Synonyms | (E)-4-(4-Dimethylaminophenyl)But-3-En-2-One; 3-Buten-2-One, 4-(4-(Dimethylamino)Phenyl)-; Sbb017113 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 |
| CAS Registry Number | 30625-58-2 |
| SMILES | C1=CC(=CC=C1N(C)C)\C=C\C(C)=O |
| InChI | 1S/C12H15NO/c1-10(14)4-5-11-6-8-12(9-7-11)13(2)3/h4-9H,1-3H3/b5-4+ |
| InChIKey | IAMOQOMGCKCSEJ-SNAWJCMRSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 340.565°C at 760 mmHg (Cal.) |
| Flash point | 132.574°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(4-Dimethylaminophenyl)But-3-En-2-One |