|
CAS#: 30631-10-8 Product: (1S,6S)-4,6-Dimethyl-3-Cyclohexene-1-Carboxylic Acid No suppilers available for the product. |
| Name | (1S,6S)-4,6-Dimethyl-3-Cyclohexene-1-Carboxylic Acid |
|---|---|
| Synonyms | (1S,6S)-4,6-dimethylcyclohex-3-enecarboxylic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 |
| CAS Registry Number | 30631-10-8 |
| SMILES | C[C@H]1CC(=CC[C@@H]1C(=O)O)C |
| InChI | 1S/C9H14O2/c1-6-3-4-8(9(10)11)7(2)5-6/h3,7-8H,4-5H2,1-2H3,(H,10,11)/t7-,8-/m0/s1 |
| InChIKey | DNMIFTCCOZVSBU-YUMQZZPRSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 257.836°C at 760 mmHg (Cal.) |
| Flash point | 121.481°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1S,6S)-4,6-Dimethyl-3-Cyclohexene-1-Carboxylic Acid |