|
CAS#: 30684-41-4 Product: 9H-Pyrido[3,4-b]Indol-1-Amine No suppilers available for the product. |
| Name | 9H-Pyrido[3,4-b]Indol-1-Amine |
|---|---|
| Synonyms | 9H-$B-Carbolin-1-Ylamine; 1-Amino-9H-Pyrido(3,4-B)Indole; 1-Aminonorharman |
| Molecular Structure | ![]() |
| Molecular Formula | C11H9N3 |
| Molecular Weight | 183.21 |
| CAS Registry Number | 30684-41-4 |
| SMILES | C2=NC(=C1[NH]C3=C(C1=C2)C=CC=C3)N |
| InChI | 1S/C11H9N3/c12-11-10-8(5-6-13-11)7-3-1-2-4-9(7)14-10/h1-6,14H,(H2,12,13) |
| InChIKey | CTVJIUHXFMNMFP-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.682°C at 760 mmHg (Cal.) |
| Flash point | 268.44°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Pyrido[3,4-b]Indol-1-Amine |