|
CAS#: 30687-21-9 Product: (E)-3-(4-Chlorophenyl)-N,N-Bis(2-Hydroxyethyl)Prop-2-Enamide No suppilers available for the product. |
| Name | (E)-3-(4-Chlorophenyl)-N,N-Bis(2-Hydroxyethyl)Prop-2-Enamide |
|---|---|
| Synonyms | (E)-3-(4-Chlorophenyl)-N,N-Bis(2-Hydroxyethyl)Acrylamide; 2-Propenamide, 3-(4-Chlorophenyl)-N,N-Bis(2-Hydroxyethyl)-; Brn 2273906 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H16ClNO3 |
| Molecular Weight | 269.73 |
| CAS Registry Number | 30687-21-9 |
| SMILES | C1=C(\C=C\C(N(CCO)CCO)=O)C=CC(=C1)Cl |
| InChI | 1S/C13H16ClNO3/c14-12-4-1-11(2-5-12)3-6-13(18)15(7-9-16)8-10-17/h1-6,16-17H,7-10H2/b6-3+ |
| InChIKey | UFDCJJCRRWOZJD-ZZXKWVIFSA-N |
| Density | 1.298g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.867°C at 760 mmHg (Cal.) |
| Flash point | 270.625°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-3-(4-Chlorophenyl)-N,N-Bis(2-Hydroxyethyl)Prop-2-Enamide |