|
CAS#: 306936-79-8 Product: 5-(6-Chloro-3-Pyridinyl)-4-Methyl-2,4-Dihydro-3H-1,2,4-Triazole-3-Thione No suppilers available for the product. |
| Name | 5-(6-Chloro-3-Pyridinyl)-4-Methyl-2,4-Dihydro-3H-1,2,4-Triazole-3-Thione |
|---|---|
| Synonyms | 5-(2-Chloropyrid-5-yl)-4-methyl-4H-1 2 4-triazole-3-thiol; 5-(2-Chlo |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7ClN4S |
| Molecular Weight | 226.69 |
| CAS Registry Number | 306936-79-8 |
| SMILES | S=C1N(C(=N/N1)\c2cnc(Cl)cc2)C |
| InChI | 1S/C8H7ClN4S/c1-13-7(11-12-8(13)14)5-2-3-6(9)10-4-5/h2-4H,1H3,(H,12,14) |
| InChIKey | JGVQHLYFJWNABJ-UHFFFAOYSA-N |
| Density | 1.548g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.529°C at 760 mmHg (Cal.) |
| Flash point | 149.465°C (Cal.) |
| Refractive index | 1.742 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(6-Chloro-3-Pyridinyl)-4-Methyl-2,4-Dihydro-3H-1,2,4-Triazole-3-Thione |