Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Perfluorodecanesulfonyl Fluoride |
|---|---|
| Synonyms | Heneicosafluoro-1-Decanesulfonyl Fluoride; Perfluorodecanesulphonyl Fluoride |
| Molecular Structure |  |
| Molecular Formula | C10F22O2S |
| Molecular Weight | 602.13 |
| CAS Registry Number | 307-51-7 |
| EINECS | 206-202-7 |
| SMILES | O=[S](C(C(C(C(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(=O)F |
| InChI | 1S/C10F22O2S/c11-1(12,3(15,16)5(19,20)7(23,24)9(27,28)29)2(13,14)4(17,18)6(21,22)8(25,26)10(30,31)35(32,33)34 |
| InChIKey | QMNUYVWNQITPHA-UHFFFAOYSA-N |
| Density | 1.798g/cm3 (Cal.) |
|---|---|
| Boiling point | 191.713°C at 760 mmHg (Cal.) |
| Flash point | 69.746°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Perfluorodecanesulfonyl Fluoride |