|
CAS#: 30799-25-8 Product: 5-Nitroacenaphthen-1-Ol No suppilers available for the product. |
| Name | 5-Nitroacenaphthen-1-Ol |
|---|---|
| Synonyms | 5-Nitro-1-Acenaphthenol; 1-Acenaphthenol, 5-Nitro-; 1-Acenaphthylenol, 1,2-Dihydro-5-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9NO3 |
| Molecular Weight | 215.21 |
| CAS Registry Number | 30799-25-8 |
| SMILES | C1=CC(=C3C2=C1CC(O)C2=CC=C3)[N+]([O-])=O |
| InChI | 1S/C12H9NO3/c14-11-6-7-4-5-10(13(15)16)8-2-1-3-9(11)12(7)8/h1-5,11,14H,6H2 |
| InChIKey | WUFIXGLQCYFLSW-UHFFFAOYSA-N |
| Density | 1.497g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.354°C at 760 mmHg (Cal.) |
| Flash point | 198.862°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Nitroacenaphthen-1-Ol |