|
CAS#: 30831-82-4 Product: (4-Chlorophenyl)-(2H-Quinolin-1-Yl)Methanone No suppilers available for the product. |
| Name | (4-Chlorophenyl)-(2H-Quinolin-1-Yl)Methanone |
|---|---|
| Synonyms | Brn 1249834; Quinoline, 1,2-Dihydro-1-(P-Chlorobenzoyl)-; Quinoline, 1-(P-Chlorobenzoyl)-1,2-Dihydro- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H12ClNO |
| Molecular Weight | 269.73 |
| CAS Registry Number | 30831-82-4 |
| SMILES | C1=CC=CC3=C1N(C(=O)C2=CC=C(Cl)C=C2)CC=C3 |
| InChI | 1S/C16H12ClNO/c17-14-9-7-13(8-10-14)16(19)18-11-3-5-12-4-1-2-6-15(12)18/h1-10H,11H2 |
| InChIKey | GPVHXPLPRPJTMZ-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 434.92°C at 760 mmHg (Cal.) |
| Flash point | 216.832°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4-Chlorophenyl)-(2H-Quinolin-1-Yl)Methanone |