|
CAS#: 30893-21-1 Product: N,N-Bis(2-Methylpropyl)Nitramide No suppilers available for the product. |
| Name | N,N-Bis(2-Methylpropyl)Nitramide |
|---|---|
| Synonyms | N,N-Diisobutylnitramide; Diisobutylnitramine; Dipropylamine, 2,2'-Dimethyl-N-Nitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H18N2O2 |
| Molecular Weight | 174.24 |
| CAS Registry Number | 30893-21-1 |
| SMILES | C(N([N+]([O-])=O)CC(C)C)C(C)C |
| InChI | 1S/C8H18N2O2/c1-7(2)5-9(10(11)12)6-8(3)4/h7-8H,5-6H2,1-4H3 |
| InChIKey | OZORBUINPDUEAL-UHFFFAOYSA-N |
| Density | 0.961g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.97°C at 760 mmHg (Cal.) |
| Flash point | 114.05°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(2-Methylpropyl)Nitramide |