Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | 6,7,8-Trimethoxyquinazoline-2,4(1H,3H)-Dione |
|---|---|
| Synonyms | 6,7,8-Trimethoxy-1H-Quinazoline-2,4-Quinone; 6,7,8-Trimethoxyquinazoline-2,4(1H,3H)-Dione |
| Molecular Structure |  |
| Molecular Formula | C11H12N2O5 |
| Molecular Weight | 252.23 |
| CAS Registry Number | 30896-98-1 |
| EINECS | 250-375-1 |
| SMILES | C1=C(OC)C(=C(C2=C1C(NC(N2)=O)=O)OC)OC |
| InChI | 1S/C11H12N2O5/c1-16-6-4-5-7(9(18-3)8(6)17-2)12-11(15)13-10(5)14/h4H,1-3H3,(H2,12,13,14,15) |
| InChIKey | QNACMQOICPJEOM-UHFFFAOYSA-N |
| Density | 1.305g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.9°C at 760 mmHg (Cal.) |
| Flash point | 267.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6,7,8-Trimethoxyquinazoline-2,4(1H,3H)-Dione |