|
CAS#: 30960-39-5 Product: Cedr-8-en-10-one No suppilers available for the product. |
| Name | Cedr-8-en-10-one |
|---|---|
| Synonyms | [3R-(3α,3 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.33 |
| CAS Registry Number | 30960-39-5 |
| EINECS | 250-405-3 |
| SMILES | O=C1\C=C(/C3CC12C(CCC2C3(C)C)C)C |
| InChI | 1S/C15H22O/c1-9-7-13(16)15-8-11(9)14(3,4)12(15)6-5-10(15)2/h7,10-12H,5-6,8H2,1-4H3 |
| InChIKey | BGDCOEHXBFJKSF-UHFFFAOYSA-N |
| Density | 1.027g/cm3 (Cal.) |
|---|---|
| Boiling point | 311.544°C at 760 mmHg (Cal.) |
| Flash point | 136.393°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cedr-8-en-10-one |