|
CAS#: 30994-75-3 Product: 2-Methyl-5-[(4-Methylphenyl)Sulfanyl]-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2-Methyl-5-[(4-Methylphenyl)Sulfanyl]-1,4-Benzoquinone |
|---|---|
| Synonyms | 2-METHYL- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12O2S |
| Molecular Weight | 244.31 |
| CAS Registry Number | 30994-75-3 |
| SMILES | CC1=CC=C(C=C1)SC2=CC(=O)C(=CC2=O)C |
| InChI | 1S/C14H12O2S/c1-9-3-5-11(6-4-9)17-14-8-12(15)10(2)7-13(14)16/h3-8H,1-2H3 |
| InChIKey | MIBWXUPDCBKVJK-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 376.0±42.0°C at 760 mmHg (Cal.) |
| Flash point | 161.9±17.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-5-[(4-Methylphenyl)Sulfanyl]-1,4-Benzoquinone |