|
CAS#: 31069-81-5 Product: 4-{(E)-2-[4-(Methylsulfanyl)Phenyl]Vinyl}Quinoline No suppilers available for the product. |
| Name | 4-{(E)-2-[4-(Methylsulfanyl)Phenyl]Vinyl}Quinoline |
|---|---|
| Synonyms | 4-(4-Methylthiostyryl)quinoline |
| Molecular Structure | ![]() |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.38 |
| CAS Registry Number | 31069-81-5 |
| SMILES | CSC1=CC=C(C=C1)/C=C/C2=CC=NC3=CC=CC=C23 |
| InChI | 1S/C18H15NS/c1-20-16-10-7-14(8-11-16)6-9-15-12-13-19-18-5-3-2-4-17(15)18/h2-13H,1H3/b9-6+ |
| InChIKey | ULHYTJRGRNPACD-RMKNXTFCSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 461.7±24.0°C at 760 mmHg (Cal.) |
| Flash point | 233.0±22.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-{(E)-2-[4-(Methylsulfanyl)Phenyl]Vinyl}Quinoline |