|
CAS#: 311-47-7 Product: [(E)-2-Chloroethenyl] Diethyl Phosphate No suppilers available for the product. |
| Name | [(E)-2-Chloroethenyl] Diethyl Phosphate |
|---|---|
| Synonyms | [(E)-2-Chlorovinyl] Diethyl Phosphate; Phosphoric Acid [(E)-2-Chlorovinyl] Diethyl Ester; Sd 1836 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H12ClO4P |
| Molecular Weight | 214.59 |
| CAS Registry Number | 311-47-7 |
| SMILES | C(O[P](O\C=C\Cl)(OCC)=O)C |
| InChI | 1S/C6H12ClO4P/c1-3-9-12(8,10-4-2)11-6-5-7/h5-6H,3-4H2,1-2H3/b6-5+ |
| InChIKey | DKMDOBOUUAGJNY-AATRIKPKSA-N |
| Density | 1.221g/cm3 (Cal.) |
|---|---|
| Boiling point | 207.839°C at 760 mmHg (Cal.) |
| Flash point | 54.874°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(E)-2-Chloroethenyl] Diethyl Phosphate |