|
CAS#: 31114-38-2 Product: 3,6,8-Trimethylpyrimido[5,4-e][1,2,4]Triazine-5,7(6H,8H)-Dione No suppilers available for the product. |
| Name | 3,6,8-Trimethylpyrimido[5,4-e][1,2,4]Triazine-5,7(6H,8H)-Dione |
|---|---|
| Synonyms | 3,6,8-Tri |
| Molecular Structure | ![]() |
| Molecular Formula | C8H9N5O2 |
| Molecular Weight | 207.19 |
| CAS Registry Number | 31114-38-2 |
| SMILES | O=C2c1nc(nnc1N(C(=O)N2C)C)C |
| InChI | 1S/C8H9N5O2/c1-4-9-5-6(11-10-4)12(2)8(15)13(3)7(5)14/h1-3H3 |
| InChIKey | IHCRFHCWINOJSU-UHFFFAOYSA-N |
| Density | 1.406g/cm3 (Cal.) |
|---|---|
| Boiling point | 427.115°C at 760 mmHg (Cal.) |
| Flash point | 212.111°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,6,8-Trimethylpyrimido[5,4-e][1,2,4]Triazine-5,7(6H,8H)-Dione |