Online Database of Chemicals from Around the World
|
CAS#: 31185-68-9 Product: 4-Ethyl-1-(Heptafluoropropyl)-2,6,7-Trioxabicyclo[2.2.2]Octane No suppilers available for the product. |
| Name | 4-Ethyl-1-(Heptafluoropropyl)-2,6,7-Trioxabicyclo[2.2.2]Octane |
|---|---|
| Synonyms | 4-ethyl-1 |
| Molecular Structure | ![CAS#: 31185-68-9, 4-Ethyl-1-(Heptafluoropropyl)-2,6,7-Trioxabicyclo[2.2.2]Octane](/moreStructures/31185-68-9.gif) |
| Molecular Formula | C10H11F7O3 |
| Molecular Weight | 312.18 |
| CAS Registry Number | 31185-68-9 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C21OCC(CO1)(CO2)CC |
| InChI | 1S/C10H11F7O3/c1-2-6-3-18-10(19-4-6,20-5-6)8(13,14)7(11,12)9(15,16)17/h2-5H2,1H3 |
| InChIKey | MEQDZELXTCMMLF-UHFFFAOYSA-N |
| Density | 1.479g/cm3 (Cal.) |
|---|---|
| Boiling point | 195.922°C at 760 mmHg (Cal.) |
| Flash point | 78.771°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethyl-1-(Heptafluoropropyl)-2,6,7-Trioxabicyclo[2.2.2]Octane |