|
CAS#: 312-96-9 Product: 2-(Trifluoromethyl)Benzoyl Fluoride No suppilers available for the product. |
| Name | 2-(Trifluoromethyl)Benzoyl Fluoride |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C8H4F4O |
| Molecular Weight | 192.11 |
| CAS Registry Number | 312-96-9 |
| EINECS | 206-235-7 |
| SMILES | C1=C(C(=CC=C1)C(=O)F)C(F)(F)F |
| InChI | 1S/C8H4F4O/c9-7(13)5-3-1-2-4-6(5)8(10,11)12/h1-4H |
| InChIKey | MPSOUKZPIUZZDZ-UHFFFAOYSA-N |
| Density | 1.34g/cm3 (Cal.) |
|---|---|
| Boiling point | 187.308°C at 760 mmHg (Cal.) |
| Flash point | 68.809°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Trifluoromethyl)Benzoyl Fluoride |