|
CAS#: 31230-13-4 Product: 2-Isopropyl-2,3A,4-Trimethyloctahydro-1H-Indene No suppilers available for the product. |
| Name | 2-Isopropyl-2,3A,4-Trimethyloctahydro-1H-Indene |
|---|---|
| Synonyms | 1H-Indene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H28 |
| Molecular Weight | 208.38 |
| CAS Registry Number | 31230-13-4 |
| SMILES | C1CCC(C)C2(CC(CC12)(C)C(C)C)C |
| InChI | 1S/C15H28/c1-11(2)14(4)9-13-8-6-7-12(3)15(13,5)10-14/h11-13H,6-10H2,1-5H3 |
| InChIKey | MELIIVLMQXZMAH-UHFFFAOYSA-N |
| Density | 0.847g/cm3 (Cal.) |
|---|---|
| Boiling point | 248.408°C at 760 mmHg (Cal.) |
| Flash point | 98.35°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Isopropyl-2,3A,4-Trimethyloctahydro-1H-Indene |