|
CAS#: 313-93-9 Product: 3-Ethyltricycloquinazoline No suppilers available for the product. |
| Name | 3-Ethyltricycloquinazoline |
|---|---|
| Synonyms | Tricycloquinazoline, 3-Ethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C23H16N4 |
| Molecular Weight | 348.41 |
| CAS Registry Number | 313-93-9 |
| SMILES | C1=CC=C2C(=C1)C3=NC6=C(C4=NC5=C(C(=N2)N34)C=CC=C5)C=C(C=C6)CC |
| InChI | 1S/C23H16N4/c1-2-14-11-12-20-17(13-14)23-25-19-10-6-4-8-16(19)21-24-18-9-5-3-7-15(18)22(26-20)27(21)23/h3-13H,2H2,1H3 |
| InChIKey | LEKKQGQZKMSQAP-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 592.713°C at 760 mmHg (Cal.) |
| Flash point | 312.262°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Ethyltricycloquinazoline |